CAS 1065074-72-7
:Ethyl 5-bromo-1H-indole-1-pentanoate
Description:
Ethyl 5-bromo-1H-indole-1-pentanoate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 5-position of the indole ring introduces notable reactivity and influences its chemical properties. The ethyl ester functional group contributes to its solubility in organic solvents and can participate in esterification and hydrolysis reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests potential biological activity, which can be explored in medicinal chemistry. The compound's CAS number, 1065074-72-7, allows for precise identification in chemical databases and literature. Safety data should be consulted for handling and storage, as the presence of bromine may pose specific hazards. Overall, Ethyl 5-bromo-1H-indole-1-pentanoate is a versatile compound with applications in various fields of chemistry.
Formula:C15H18BrNO2
InChI:InChI=1S/C15H18BrNO2/c1-2-19-15(18)5-3-4-9-17-10-8-12-11-13(16)6-7-14(12)17/h6-8,10-11H,2-5,9H2,1H3
InChI key:InChIKey=GNJZABGSSONURL-UHFFFAOYSA-N
SMILES:C(CCCC(OCC)=O)N1C=2C(C=C1)=CC(Br)=CC2
Synonyms:- Ethyl 5-bromo-1H-indole-1-pentanoate
- 1H-Indole-1-pentanoic acid, 5-bromo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
