CAS 1065074-77-2
:1-Chloro-4-methyl-2-(phenylmethoxy)benzene
Description:
1-Chloro-4-methyl-2-(phenylmethoxy)benzene, identified by its CAS number 1065074-77-2, is an organic compound characterized by a chlorobenzene structure with additional functional groups. It features a chlorine atom and a methyl group attached to a benzene ring, as well as a phenylmethoxy group, which contributes to its overall reactivity and solubility properties. This compound is likely to exhibit moderate polarity due to the presence of the ether linkage from the phenylmethoxy group, influencing its solubility in organic solvents. The chlorinated aromatic structure may impart certain stability and resistance to degradation, while also allowing for potential electrophilic substitution reactions. Its synthesis typically involves the introduction of the chloro and methoxy groups onto a benzene ring, which can be achieved through various organic reactions. The compound's specific applications and behavior in chemical reactions would depend on its functional groups and the surrounding chemical environment, making it of interest in fields such as organic synthesis and materials science.
Formula:C14H13ClO
InChI:InChI=1S/C14H13ClO/c1-11-7-8-13(15)14(9-11)16-10-12-5-3-2-4-6-12/h2-9H,10H2,1H3
InChI key:InChIKey=XVOREKXLRMZNBK-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(Cl)C=CC(C)=C2
Synonyms:- 1-Chloro-4-methyl-2-(phenylmethoxy)benzene
- Benzene, 1-chloro-4-methyl-2-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
