CAS 1065075-71-9

1,1-Dimethylethyl N-[3-(4-bromophenyl)-2-(4-chlorophenyl)propyl]carbamate

Description:

1,1-Dimethylethyl N-[3-(4-bromophenyl)-2-(4-chlorophenyl)propyl]carbamate, identified by its CAS number 1065075-71-9, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by a tert-butyl group (1,1-dimethylethyl) attached to a carbamate functional group, which is linked to a propyl chain that bears two aromatic substituents: a bromophenyl and a chlorophenyl group. The presence of these halogenated aromatic rings suggests potential applications in pharmaceuticals or agrochemicals, as such modifications can enhance biological activity or selectivity. The compound's physical properties, such as solubility, melting point, and stability, would depend on its molecular interactions and the nature of the substituents. Additionally, the presence of halogens may influence its reactivity and environmental behavior. As with many carbamates, it is essential to consider safety and handling protocols due to potential toxicity and environmental impact.

Formula: C₂₀H₂₃BrClNO₂

InChI: InChI=1S/C20H23BrClNO2/c1-20(2,3)25-19(24)23-13-16(15-6-10-18(22)11-7-15)12-14-4-8-17(21)9-5-14/h4-11,16H,12-13H2,1-3H3,(H,23,24)

InChI key: InChIKey=MWYMXOVWDWBALF-UHFFFAOYSA-N

SMILES: C(CC1=CC=C(Br)C=C1)(CNC(OC(C)(C)C)=O)C2=CC=C(Cl)C=C2

Synonyms:

• 1,1-Dimethylethyl N-[3-(4-bromophenyl)-2-(4-chlorophenyl)propyl]carbamate
• Carbamic acid, N-[3-(4-bromophenyl)-2-(4-chlorophenyl)propyl]-, 1,1-dimethylethyl ester