CAS 1065075-74-2

2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-5-(2-methoxyethoxy)benzoic acid

Description:

2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-5-(2-methoxyethoxy)benzoic acid, with CAS number 1065075-74-2, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety, a fluorenylmethoxycarbonyl (Fmoc) protecting group, and a methoxyethoxy substituent. This compound is typically used in organic synthesis, particularly in peptide synthesis, where the Fmoc group serves as a protective group for amino acids. The presence of the methoxyethoxy group enhances its solubility in organic solvents, making it suitable for various synthetic applications. The compound is likely to exhibit moderate to high stability under standard laboratory conditions, although it may be sensitive to strong acids or bases due to the presence of the carboxylic acid functional group. Its molecular structure suggests potential for interactions such as hydrogen bonding, which can influence its reactivity and solubility. Overall, this compound is valuable in the field of medicinal chemistry and peptide synthesis due to its functional versatility.

Formula: C₂₅H₂₃NO₆

InChI: InChI=1S/C25H23NO6/c1-30-12-13-31-16-10-11-23(21(14-16)24(27)28)26-25(29)32-15-22-19-8-4-2-6-17(19)18-7-3-5-9-20(18)22/h2-11,14,22H,12-13,15H2,1H3,(H,26,29)(H,27,28)

InChI key: InChIKey=HKENVONEMQHWQN-UHFFFAOYSA-N

SMILES: C(OC(NC1=C(C(O)=O)C=C(OCCOC)C=C1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• 2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-5-(2-methoxyethoxy)benzoic acid
• Benzoic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-5-(2-methoxyethoxy)-