CAS 1065076-04-1

5,7-Bis(trifluoromethyl)-4-quinolinethiol

Description:

5,7-Bis(trifluoromethyl)-4-quinolinethiol is a chemical compound characterized by its unique structure, which includes a quinoline core substituted with two trifluoromethyl groups and a thiol functional group. The presence of the trifluoromethyl groups enhances the compound's lipophilicity and may influence its reactivity and biological activity. The thiol group (-SH) is known for its ability to participate in redox reactions and can form disulfide bonds, making the compound potentially useful in various chemical and biological applications. This compound may exhibit interesting properties such as fluorescence or photostability, which can be advantageous in analytical chemistry or material science. Additionally, the trifluoromethyl groups can impart unique electronic properties, potentially affecting the compound's interaction with biological targets. Overall, 5,7-Bis(trifluoromethyl)-4-quinolinethiol represents a versatile structure with potential applications in pharmaceuticals, agrochemicals, and materials science, although specific applications would depend on further research and characterization.

Formula: C₁₁H₅F₆NS

InChI: InChI=1S/C11H5F6NS/c12-10(13,14)5-3-6(11(15,16)17)9-7(4-5)18-2-1-8(9)19/h1-4H,(H,18,19)

InChI key: InChIKey=JUZFQQKELJLGFV-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C2=C(C=C(C(F)(F)F)C1)N=CC=C2S

Synonyms:

• 4-Quinolinethiol, 5,7-bis(trifluoromethyl)-
• 5,7-Bis(trifluoromethyl)-4-quinolinethiol

5,7-Bis(trifluoromethyl)quinoline-4-thiol

CAS: 1065076-04-1

5,7-Bis(trifluoromethyl)quinoline-4-thiol

Purity: ≥95%

Molecular weight: 297.22g/mol

Ref: 54-PC103704