CAS 1065076-39-2
:2-bromo-4-fluoro-5-methyl-aniline
Description:
2-Bromo-4-fluoro-5-methyl-aniline is an organic compound characterized by the presence of an aniline group, which is an amino-substituted aromatic ring. The compound features a bromine atom at the second position, a fluorine atom at the fourth position, and a methyl group at the fifth position of the benzene ring. This substitution pattern contributes to its unique chemical properties, including its reactivity and potential applications in various fields such as pharmaceuticals and agrochemicals. The presence of halogens (bromine and fluorine) typically enhances the compound's lipophilicity and can influence its biological activity. Additionally, the amino group (-NH2) allows for hydrogen bonding, which can affect solubility and interaction with other molecules. The compound's molecular structure suggests it may participate in electrophilic aromatic substitution reactions and could serve as a precursor for further chemical modifications. Safety data and handling precautions should be considered due to the presence of halogens and the potential for toxicity associated with aniline derivatives.
Formula:C7H7BrFN
InChI:InChI=1S/C7H7BrFN/c1-4-2-7(10)5(8)3-6(4)9/h2-3H,10H2,1H3
SMILES:Cc1cc(c(cc1F)Br)N
Synonyms:- 2-Fluoro-4-bromo-5-aminotoluene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Fluoro-4-BroMo-5-AMinotoluene
CAS:Formula:C7H7BrFNPurity:98%Color and Shape:SolidMolecular weight:204.03962-Bromo-4-fluoro-5-methylaniline
CAS:2-Bromo-4-fluoro-5-methylanilinePurity:98+%Color and Shape:SolidMolecular weight:204.04g/mol2-Bromo-4-fluoro-5-methylaniline
CAS:<p>2-Bromo-4-fluoro-5-methylaniline (BFM) is a reactive intermediate that is used as a building block in the synthesis of various organic compounds. It is also used in research and development for the preparation of pharmaceuticals, pesticides, herbicides, and dyes. BFM is a versatile intermediate that can be used in many different types of reactions. This chemical belongs to the group of halogenated methylanilines and has a CAS number of 1065076-39-2.</p>Formula:C7H7BrFNPurity:Min. 95%Color and Shape:PowderMolecular weight:204.04 g/mol2-Bromo-4-fluoro-5-methyl-aniline
CAS:Formula:C7H7BrFNPurity:98%Color and Shape:SolidMolecular weight:204.042



