CAS 1065076-52-9

4-(Trifluoromethyl)benzofuran

Description:

4-(Trifluoromethyl)benzofuran is an organic compound characterized by the presence of a benzofuran moiety substituted with a trifluoromethyl group at the 4-position of the benzofuran ring. This compound typically exhibits a molecular structure that combines the aromatic properties of benzofuran with the electronegative trifluoromethyl group, which can significantly influence its chemical reactivity and physical properties. The trifluoromethyl group is known for imparting unique characteristics, such as increased lipophilicity and potential for enhanced biological activity. In terms of solubility, compounds with trifluoromethyl groups often show varied solubility in organic solvents, and their stability can be affected by environmental conditions. Additionally, 4-(Trifluoromethyl)benzofuran may exhibit interesting electronic properties due to the electron-withdrawing nature of the trifluoromethyl group, which can affect its behavior in chemical reactions, including electrophilic substitutions. Overall, this compound is of interest in fields such as medicinal chemistry and materials science due to its unique structural features and potential applications.

Formula: C₉H₅F₃O

InChI: InChI=1S/C9H5F3O/c10-9(11,12)7-2-1-3-8-6(7)4-5-13-8/h1-5H

InChI key: InChIKey=VLACSJKCZFFVQE-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C2C(=CC=C1)OC=C2

Synonyms:

• 4-(Trifluoromethyl)benzofuran
• Benzofuran, 4-(trifluoromethyl)-