CAS 1065087-86-6
:3-Bromo-6-(trifluoromethoxy)-4-quinolinol
Description:
3-Bromo-6-(trifluoromethoxy)-4-quinolinol is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. The presence of a bromine atom at the 3-position and a trifluoromethoxy group at the 6-position contributes to its unique reactivity and potential applications in medicinal chemistry. This compound exhibits properties typical of halogenated quinolines, such as increased lipophilicity and potential biological activity. The trifluoromethoxy group enhances its electronic properties, potentially influencing its interaction with biological targets. Additionally, the compound may exhibit antimicrobial or anticancer activities, making it of interest in pharmaceutical research. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with tailored properties. As with many halogenated compounds, safety precautions should be observed due to potential toxicity and environmental impact. Overall, 3-Bromo-6-(trifluoromethoxy)-4-quinolinol represents a valuable compound in the field of organic chemistry and drug development.
Formula:C10H5BrF3NO2
InChI:InChI=1S/C10H5BrF3NO2/c11-7-4-15-8-2-1-5(17-10(12,13)14)3-6(8)9(7)16/h1-4H,(H,15,16)
InChI key:InChIKey=XSIHWAFZDYHXDG-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=CC(OC(F)(F)F)=C2)N=CC1Br
Synonyms:- 3-Bromo-6-(trifluoromethoxy)-4-quinolinol
- 4-Quinolinol, 3-bromo-6-(trifluoromethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.