CAS 1065092-30-9
:6-Chloro-7-fluoro-4-quinolinol
Description:
6-Chloro-7-fluoro-4-quinolinol is a chemical compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of chlorine and fluorine substituents at the 6 and 7 positions, respectively, contributes to its unique chemical properties, including potential biological activity. This compound typically exhibits a pale yellow to off-white solid appearance and is soluble in organic solvents, though its solubility in water may be limited. The functional groups present in 6-chloro-7-fluoro-4-quinolinol suggest that it may participate in hydrogen bonding and exhibit weak acidity due to the hydroxyl group. Its structural features may confer antimicrobial or antiviral properties, making it of interest in medicinal chemistry. Additionally, the compound's reactivity can be influenced by the electron-withdrawing effects of the halogen substituents, which may affect its interaction with biological targets. As with many quinoline derivatives, it may also be subject to various synthetic routes for its preparation and modification for specific applications in pharmaceuticals or agrochemicals.
Formula:C9H5ClFNO
InChI:InChI=1S/C9H5ClFNO/c10-6-3-5-8(4-7(6)11)12-2-1-9(5)13/h1-4H,(H,12,13)
InChI key:InChIKey=LZWJGBQOZHIGPU-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=C(F)C(Cl)=C2)N=CC1
Synonyms:- 4-Quinolinol, 6-chloro-7-fluoro-
- 6-Chloro-7-fluoro-4-quinolinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.