CAS 1065100-86-8
:1,1-Dimethylethyl 4-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-1-piperazinecarboxylate
Description:
1,1-Dimethylethyl 4-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-1-piperazinecarboxylate, with the CAS number 1065100-86-8, is a chemical compound characterized by its complex structure, which includes a piperazine ring and a pyrrolopyridine moiety. This compound typically exhibits properties associated with both piperazine derivatives and heterocyclic compounds, including potential biological activity. It may possess lipophilic characteristics due to the presence of the dimethyl group, which can influence its solubility and permeability in biological systems. The compound's functional groups suggest it may engage in hydrogen bonding and other interactions, making it of interest in medicinal chemistry for potential therapeutic applications. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for pharmacological properties, including receptor binding affinity or enzyme inhibition. As with many compounds in this class, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C17H24N4O2
InChI:InChI=1S/C17H24N4O2/c1-17(2,3)23-16(22)21-9-7-20(8-10-21)12-13-11-19-15-14(13)5-4-6-18-15/h4-6,11H,7-10,12H2,1-3H3,(H,18,19)
InChI key:InChIKey=VLYSQQLGOQCNQR-UHFFFAOYSA-N
SMILES:C(C=1C=2C(NC1)=NC=CC2)N3CCN(C(OC(C)(C)C)=O)CC3
Synonyms:- 1-Piperazinecarboxylic acid, 4-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 4-(1H-pyrrolo[2,3-b]pyridin-3-ylmethyl)-1-piperazinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.