CymitQuimica logo

CAS 106513-42-2

:

ethyl (S)-(-)-2-(tert-butyldimethylsilyl-oxy)prop

Description:
Ethyl (S)-(-)-2-(tert-butyldimethylsilyl-oxy)prop, identified by its CAS number 106513-42-2, is an organic compound characterized by its chiral structure, which includes a tert-butyldimethylsilyl (TBDMS) protecting group. This compound features a propanol backbone with an ethyl group and a silyl ether functional group, making it relevant in organic synthesis, particularly in the protection of alcohols during multi-step reactions. The presence of the chiral center contributes to its stereochemical properties, which can influence its reactivity and interactions in various chemical environments. Typically, compounds like this are utilized in the synthesis of more complex molecules, especially in the pharmaceutical and agrochemical industries. Its physical properties, such as boiling point and solubility, would depend on the specific conditions and the presence of other functional groups. Overall, this compound exemplifies the importance of protecting groups in synthetic organic chemistry, allowing for selective reactions and the manipulation of molecular structures.
Formula:C11H24O3Si
InChI:InChI=1/C11H24O3Si/c1-8-13-10(12)9(2)14-15(6,7)11(3,4)5/h9H,8H2,1-7H3/t9-/m0/s1
InChI key:KOBAXFIJEBLKRZ-VIFPVBQESA-N
SMILES:CCOC(=O)[C@H](C)O[Si](C)(C)C(C)(C)C
Synonyms:
  • Ethyl (S)-()-2-(tert-butyldimethylsilyloxy)propionate
  • ethyl (2S)-2-{[tert-butyl(dimethyl)silyl]oxy}propanoate
Found 4 products.