CymitQuimica logo

CAS 106515-77-9

:

2-(3-OXO-PROPYL)-BENZOIC ACID METHYL ESTER

Description:
2-(3-Oxo-propyl)-benzoic acid methyl ester, with the CAS number 106515-77-9, is an organic compound characterized by its ester functional group and a benzoic acid moiety. This compound features a propanoyl group attached to the benzene ring, which contributes to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the ester group suggests that it may exhibit moderate polarity, influencing its solubility in organic solvents while being less soluble in water. The compound may participate in various chemical reactions, including hydrolysis, transesterification, and potential electrophilic aromatic substitution due to the reactive sites on the benzene ring. Its structure indicates potential applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical compounds. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H12O3
InChI:InChI=1/C11H12O3/c1-14-11(13)10-7-3-2-5-9(10)6-4-8-12/h2-3,5,7-8H,4,6H2,1H3
Synonyms:
  • methyl 2-(3-oxopropyl)benzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.