CymitQuimica logo

CAS 1065185-02-5

:

B-[5-(Cyanomethyl)-3-thienyl]boronic acid

Description:
B-[5-(Cyanomethyl)-3-thienyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a thienyl ring, which is a five-membered aromatic ring containing sulfur. The cyanomethyl group, a nitrile functional group (-C≡N) attached to a methylene (-CH2-) unit, enhances the compound's reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically used in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is a key method for forming carbon-carbon bonds in the synthesis of complex organic molecules. Its boronic acid functionality allows it to form reversible complexes with diols, making it useful in sensor applications and as a building block in the development of pharmaceuticals. Additionally, the presence of the thienyl moiety may impart unique electronic properties, potentially influencing the compound's behavior in various chemical environments. Overall, B-[5-(Cyanomethyl)-3-thienyl]boronic acid is a versatile compound with significant implications in both research and industrial applications.
Formula:C6H6BNO2S
InChI:InChI=1S/C6H6BNO2S/c8-2-1-6-3-5(4-11-6)7(9)10/h3-4,9-10H,1H2
InChI key:InChIKey=XEXQGVOXHWCUGN-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C=C(CC#N)SC1
Synonyms:
  • B-[5-(Cyanomethyl)-3-thienyl]boronic acid
  • 5-(Cyanomethyl)-3-thiopheneboronic acid
  • Boronic acid, B-[5-(cyanomethyl)-3-thienyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.