CAS 106531-54-8

2-Methylfuro[2,3-c]pyridin-3(2H)-one

Description:

2-Methylfuro[2,3-c]pyridin-3(2H)-one, with the CAS number 106531-54-8, is a heterocyclic organic compound characterized by its fused furan and pyridine rings. This compound features a methyl group at the 2-position of the furan ring and a carbonyl group at the 3-position of the pyridine moiety, contributing to its unique chemical properties. It typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics. The presence of both nitrogen and oxygen in its structure allows for potential hydrogen bonding and reactivity in various chemical reactions, making it of interest in synthetic organic chemistry and medicinal chemistry. Its derivatives may possess biological activity, which can be explored for pharmaceutical applications. The compound's stability, reactivity, and potential applications are influenced by its structural features, making it a subject of interest for further research in the fields of organic synthesis and drug development.

Formula: C₈H₇NO₂

InChI: InChI=1S/C8H7NO2/c1-5-8(10)6-2-3-9-4-7(6)11-5/h2-5H,1H3

InChI key: InChIKey=OZQXPHITVRUPFZ-UHFFFAOYSA-N

SMILES: O=C1C=2C(OC1C)=CN=CC2

Synonyms:

• 2-Methyl-2H,3H-furo[2,3-c]pyridin-3-one
• Furo[2,3-c]pyridin-3(2H)-one, 2-methyl-
• 2-Methylfuro[2,3-c]pyridin-3(2H)-one