CAS 106535-28-8

Ethanone, 1-(1-methyl-1H-1,2,4-triazol-5-yl)- (9CI)

Description:

Ethanone, 1-(1-methyl-1H-1,2,4-triazol-5-yl)-, also known by its CAS number 106535-28-8, is a chemical compound characterized by its triazole ring structure, which contributes to its biological activity. This compound typically appears as a colorless to light yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which facilitates its use in various chemical reactions and applications. The presence of the triazole moiety suggests potential antifungal or herbicidal properties, making it of interest in agricultural chemistry. Additionally, the ethanone functional group indicates that it may participate in nucleophilic addition reactions, enhancing its versatility in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, this compound exemplifies the intersection of organic chemistry and practical applications in fields such as agriculture and pharmaceuticals.

Formula: C₅H₇N₃O

InChI: InChI=1/C5H7N3O/c1-4(9)5-6-3-7-8(5)2/h3H,1-2H3

SMILES: CC(=O)c1ncnn1C

1-(1-Methyl-1H-1,2,4-triazol-5-yl)ethanone

CAS: 106535-28-8

Formula: C₅H₇N₃O

Molecular weight: 125.1286

Ref: IN-DA008TXZ

1-(1-methyl-1H-1,2,4-triazol-5-yl)ethanone

CAS: 106535-28-8

Formula: C₅H₇N₃O

Purity: 95.0%

Molecular weight: 125.131

Ref: 10-F310356

Ethanone, 1-(1-methyl-1H-1,2,4-triazol-5-yl)-

CAS: 106535-28-8

Versatile small molecule scaffold

Formula: C₅H₇N₃O

Purity: Min. 95%

Molecular weight: 125.13 g/mol

Ref: 3D-GEA53528