CymitQuimica logo

CAS 106535-30-2

:

1-(1-Phenyl-1H-1,2,4-triazol-5-yl)ethanone

Description:
1-(1-Phenyl-1H-1,2,4-triazol-5-yl)ethanone, with the CAS number 106535-30-2, is a chemical compound characterized by its triazole ring structure, which contributes to its potential biological activity. This compound features a phenyl group attached to a triazole, enhancing its stability and reactivity. The ethanone functional group indicates the presence of a carbonyl (C=O) moiety, which is significant for its reactivity in various chemical reactions, including nucleophilic attacks. The triazole ring is known for its role in pharmaceuticals, particularly as a scaffold in antifungal and antimicrobial agents. The compound may exhibit properties such as moderate solubility in organic solvents and potential interactions with biological targets, making it of interest in medicinal chemistry. Its synthesis typically involves the reaction of appropriate precursors under controlled conditions, and it may be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity. Overall, this compound represents a class of heterocyclic compounds with diverse applications in chemistry and pharmacology.
Formula:C10H9N3O
InChI:InChI=1S/C10H9N3O/c1-8(14)10-11-7-12-13(10)9-5-3-2-4-6-9/h2-7H,1H3
InChI key:InChIKey=GDAMOINVGYNMKD-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1N(N=CN1)C2=CC=CC=C2
Synonyms:
  • 1-(1-Phenyl-1H-1,2,4-triazol-5-yl)ethan-1-one
  • 1-(1-Phenyl-1H-1,2,4-triazol-5-yl)ethanone
  • Ethanone, 1-(1-phenyl-1H-1,2,4-triazol-5-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.