CAS 1065483-91-1
:1-(1-Ethyl-1H-benzimidazol-2-yl)-3-piperidinol
Description:
1-(1-Ethyl-1H-benzimidazol-2-yl)-3-piperidinol is a chemical compound characterized by its unique structural features, which include a benzimidazole moiety and a piperidinol group. The benzimidazole ring contributes to its potential biological activity, often associated with various pharmacological properties. The presence of the ethyl group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The piperidinol portion of the molecule may impart additional functional properties, such as the ability to form hydrogen bonds, which can be crucial for interactions with biological targets. This compound may exhibit a range of activities, including antimicrobial, antifungal, or other therapeutic effects, depending on its specific interactions at the molecular level. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the functional groups present. As with many compounds in medicinal chemistry, understanding its pharmacokinetics and pharmacodynamics is essential for evaluating its potential applications in drug development.
Formula:C14H19N3O
InChI:InChI=1S/C14H19N3O/c1-2-17-13-8-4-3-7-12(13)15-14(17)16-9-5-6-11(18)10-16/h3-4,7-8,11,18H,2,5-6,9-10H2,1H3
InChI key:InChIKey=REMCBOODWHDQSS-UHFFFAOYSA-N
SMILES:C(C)N1C(=NC=2C1=CC=CC2)N3CC(O)CCC3
Synonyms:- 3-Piperidinol, 1-(1-ethyl-1H-benzimidazol-2-yl)-
- 1-(1-Ethyl-1H-benzimidazol-2-yl)-3-piperidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.