CAS 1065483-94-4

1-(1-Ethyl-1H-benzimidazol-2-yl)-3-piperidinemethanol

Description:

1-(1-Ethyl-1H-benzimidazol-2-yl)-3-piperidinemethanol, identified by its CAS number 1065483-94-4, is a chemical compound that features a complex structure combining a benzimidazole moiety with a piperidine derivative. This compound typically exhibits characteristics such as moderate solubility in organic solvents and potential bioactivity, which may be attributed to its structural components. The presence of the benzimidazole ring often suggests potential pharmacological properties, as this class of compounds is known for various biological activities, including antimicrobial and anticancer effects. The piperidine part of the molecule may contribute to its ability to interact with biological targets, possibly influencing its pharmacokinetics and pharmacodynamics. Additionally, the hydroxymethyl group can enhance solubility and reactivity, making it a candidate for further chemical modifications. Overall, this compound's unique structural features may render it of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation.

Formula: C₁₅H₂₁N₃O

InChI: InChI=1S/C15H21N3O/c1-2-18-14-8-4-3-7-13(14)16-15(18)17-9-5-6-12(10-17)11-19/h3-4,7-8,12,19H,2,5-6,9-11H2,1H3

InChI key: InChIKey=WMLWTORZYORCTM-UHFFFAOYSA-N

SMILES: C(C)N1C(=NC=2C1=CC=CC2)N3CC(CO)CCC3

Synonyms:

• 3-Piperidinemethanol, 1-(1-ethyl-1H-benzimidazol-2-yl)-
• 1-(1-Ethyl-1H-benzimidazol-2-yl)-3-piperidinemethanol
• [1-(1-ethylbenzimidazol-2-yl)piperidin-3-yl]methanol
• [1-(1-Ethyl-1H-benzoiMidazol-2-yl)-piperidin-3-yl]-Methanol, 98+% C15H21N3O, MW: 259.35