CymitQuimica logo

CAS 1065484-17-4

:

1-(1H-Benzimidazol-2-yl)-3-piperidinol

Description:
1-(1H-Benzimidazol-2-yl)-3-piperidinol is a chemical compound characterized by its unique structural features, which include a benzimidazole moiety and a piperidinol group. The benzimidazole ring contributes to its potential biological activity, often associated with various pharmacological properties, including antimicrobial and anticancer effects. The piperidinol portion of the molecule introduces a secondary amine, which can participate in hydrogen bonding and influence the compound's solubility and reactivity. This compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the presence of hydroxyl and nitrogen functional groups. Its molecular interactions can be significant in drug design, particularly in the development of therapeutics targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 1-(1H-Benzimidazol-2-yl)-3-piperidinol represents a class of compounds with potential applications in medicinal chemistry and pharmacology.
Formula:C12H15N3O
InChI:InChI=1S/C12H15N3O/c16-9-4-3-7-15(8-9)12-13-10-5-1-2-6-11(10)14-12/h1-2,5-6,9,16H,3-4,7-8H2,(H,13,14)
InChI key:InChIKey=QLEFFLIVUDWFQV-UHFFFAOYSA-N
SMILES:OC1CN(C=2NC=3C(N2)=CC=CC3)CCC1
Synonyms:
  • 1-(1H-Benzimidazol-2-yl)-3-piperidinol
  • 3-Piperidinol, 1-(1H-benzimidazol-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.