CymitQuimica logo

CAS 1065484-23-2

:

1-[6-(Diethylamino)-4-pyrimidinyl]-3-piperidinol

Description:
1-[6-(Diethylamino)-4-pyrimidinyl]-3-piperidinol, identified by its CAS number 1065484-23-2, is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and a piperidinol moiety. This compound typically exhibits properties associated with its functional groups, such as basicity due to the presence of the diethylamino group and potential hydrogen-bonding capabilities from the hydroxyl group in the piperidinol structure. It may display moderate to high solubility in polar solvents, influenced by its amine and alcohol functionalities. The compound is of interest in medicinal chemistry, potentially serving as a lead compound in drug development due to its biological activity, which may include interactions with specific receptors or enzymes. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be assessed under various conditions. As with many organic compounds, safety data sheets should be consulted for handling and toxicity information.
Formula:C13H22N4O
InChI:InChI=1S/C13H22N4O/c1-3-16(4-2)12-8-13(15-10-14-12)17-7-5-6-11(18)9-17/h8,10-11,18H,3-7,9H2,1-2H3
InChI key:InChIKey=IRJPKTCLIARWBE-UHFFFAOYSA-N
SMILES:N(CC)(CC)C1=CC(=NC=N1)N2CC(O)CCC2
Synonyms:
  • 3-Piperidinol, 1-[6-(diethylamino)-4-pyrimidinyl]-
  • 1-[6-(Diethylamino)-4-pyrimidinyl]-3-piperidinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.