CAS 1065484-32-3: 2-Chloro-N-[(6-chloro-3-pyridinyl)methyl]acetamide

Description:2-Chloro-N-[(6-chloro-3-pyridinyl)methyl]acetamide is a chemical compound characterized by its specific functional groups and structural features. It contains a chloro substituent on both the acetamide and pyridine rings, which can influence its reactivity and biological activity. The presence of the pyridine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure includes an acetamide moiety, which is known for its ability to form hydrogen bonds, potentially enhancing solubility and interaction with biological systems. Additionally, the chlorine atoms may impart unique electronic properties, affecting the compound's overall stability and reactivity. This substance is typically studied for its potential applications in pharmaceuticals or agrochemicals, where its specific interactions can be leveraged for therapeutic or protective effects. As with many chemical compounds, safety data and handling precautions are essential due to the presence of halogenated groups, which may pose environmental and health risks.

Formula:C₈H₈Cl₂N₂O

InChI:InChI=1S/C8H8Cl2N2O/c9-3-8(13)12-5-6-1-2-7(10)11-4-6/h1-2,4H,3,5H2,(H,12,13)

InChI key:InChIKey=PGBDRVRZGZPHNP-UHFFFAOYSA-N

SMILES:O=C(NCC1=CN=C(Cl)C=C1)CCl

Synonyms:
2-Chloro-N-[(6-chloro-3-pyridinyl)methyl]acetamide
Acetamide, 2-chloro-N-[(6-chloro-3-pyridinyl)methyl]-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	2-Chloro-N-(6-chloro-pyridin-3-ylmethyl)-acetamide REF: 10-F086667CAS: 1065484-32-3	- - -	- - -	Discontinued product
	2-Chloro-N-(6-chloro-pyridin-3-ylmethyl)-acetamide REF: 3D-QSB48432CAS: 1065484-32-3	Min. 95%	- - -	Discontinued product