CymitQuimica logo

CAS 1065484-32-3

:

2-Chloro-N-[(6-chloro-3-pyridinyl)methyl]acetamide

Description:
2-Chloro-N-[(6-chloro-3-pyridinyl)methyl]acetamide is a chemical compound characterized by its specific functional groups and structural features. It contains a chloro substituent on both the acetamide and pyridine rings, which can influence its reactivity and biological activity. The presence of the pyridine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure includes an acetamide moiety, which is known for its ability to form hydrogen bonds, potentially enhancing solubility and interaction with biological systems. Additionally, the chlorine atoms may impart unique electronic properties, affecting the compound's overall stability and reactivity. This substance is typically studied for its potential applications in pharmaceuticals or agrochemicals, where its specific interactions can be leveraged for therapeutic or protective effects. As with many chemical compounds, safety data and handling precautions are essential due to the presence of halogenated groups, which may pose environmental and health risks.
Formula:C8H8Cl2N2O
InChI:InChI=1S/C8H8Cl2N2O/c9-3-8(13)12-5-6-1-2-7(10)11-4-6/h1-2,4H,3,5H2,(H,12,13)
InChI key:InChIKey=PGBDRVRZGZPHNP-UHFFFAOYSA-N
SMILES:C(NC(CCl)=O)C=1C=CC(Cl)=NC1
Synonyms:
  • 2-Chloro-N-[(6-chloro-3-pyridinyl)methyl]acetamide
  • Acetamide, 2-chloro-N-[(6-chloro-3-pyridinyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.