CymitQuimica logo

CAS 1065484-45-8

:

1-(1-Methyl-1H-benzimidazol-2-yl)-3-piperidinol

Description:
1-(1-Methyl-1H-benzimidazol-2-yl)-3-piperidinol, with the CAS number 1065484-45-8, is a chemical compound characterized by its unique structural features, including a benzimidazole moiety and a piperidinol group. The presence of the benzimidazole ring contributes to its potential biological activity, as this class of compounds is often associated with various pharmacological properties. The piperidinol portion of the molecule introduces a secondary amine, which can participate in hydrogen bonding and influence the compound's solubility and reactivity. This compound may exhibit properties such as moderate to high polarity, depending on the functional groups present, and it is likely to be soluble in polar solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies on its pharmacokinetics, toxicity, and therapeutic efficacy would be necessary to fully understand its potential uses and safety profile.
Formula:C13H17N3O
InChI:InChI=1S/C13H17N3O/c1-15-12-7-3-2-6-11(12)14-13(15)16-8-4-5-10(17)9-16/h2-3,6-7,10,17H,4-5,8-9H2,1H3
InChI key:InChIKey=SPLVJDRDMWPEFR-UHFFFAOYSA-N
SMILES:CN1C(=NC=2C1=CC=CC2)N3CC(O)CCC3
Synonyms:
  • 3-Piperidinol, 1-(1-methyl-1H-benzimidazol-2-yl)-
  • 1-(1-Methyl-1H-benzimidazol-2-yl)-3-piperidinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.