
CAS 1065484-48-1
:2-Chloro-N-[1-(3-nitro-2-pyridinyl)-3-piperidinyl]acetamide
Description:
2-Chloro-N-[1-(3-nitro-2-pyridinyl)-3-piperidinyl]acetamide is a chemical compound characterized by its complex structure, which includes a chloro group, a nitro-substituted pyridine, and a piperidine moiety. This compound typically exhibits properties associated with both amides and heterocyclic compounds, such as moderate solubility in polar solvents and potential biological activity due to its structural features. The presence of the chloro and nitro groups may impart specific reactivity and influence its interaction with biological targets. Additionally, the piperidine ring contributes to its basicity and potential for forming hydrogen bonds, which can affect its pharmacokinetic properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural attributes that could lead to specific therapeutic effects. As with many chemical substances, safety and handling precautions should be observed, given the potential toxicity associated with certain functional groups present in its structure.
Formula:C12H15ClN4O3
InChI:InChI=1S/C12H15ClN4O3/c13-7-11(18)15-9-3-2-6-16(8-9)12-10(17(19)20)4-1-5-14-12/h1,4-5,9H,2-3,6-8H2,(H,15,18)
InChI key:InChIKey=ZQVJKTVISMOXRF-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(N=CC=C1)N2CC(NC(CCl)=O)CCC2
Synonyms:- Acetamide, 2-chloro-N-[1-(3-nitro-2-pyridinyl)-3-piperidinyl]-
- 2-Chloro-N-[1-(3-nitro-2-pyridinyl)-3-piperidinyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.