CymitQuimica logo

CAS 1065484-49-2

:

2-Chloro-N-[1-(3-cyano-2-pyridinyl)-4-piperidinyl]acetamide

Description:
2-Chloro-N-[1-(3-cyano-2-pyridinyl)-4-piperidinyl]acetamide is a chemical compound characterized by its complex structure, which includes a chloro group, a cyano group, and a piperidine moiety. This compound features a pyridine ring, which contributes to its aromatic properties, and a piperidine ring that enhances its potential biological activity. The presence of the chloro substituent suggests that it may participate in nucleophilic substitution reactions, while the cyano group can serve as a versatile functional group in various chemical transformations. The compound's molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its unique combination of functional groups may influence its solubility, stability, and reactivity, making it a subject of interest for further research in drug design and synthesis. Overall, 2-Chloro-N-[1-(3-cyano-2-pyridinyl)-4-piperidinyl]acetamide exemplifies the intricate relationship between molecular structure and chemical behavior, which is crucial in the field of organic chemistry.
Formula:C13H15ClN4O
InChI:InChI=1S/C13H15ClN4O/c14-8-12(19)17-11-3-6-18(7-4-11)13-10(9-15)2-1-5-16-13/h1-2,5,11H,3-4,6-8H2,(H,17,19)
InChI key:InChIKey=DTUZBCPSNDKVIO-UHFFFAOYSA-N
SMILES:C(#N)C1=C(N=CC=C1)N2CCC(NC(CCl)=O)CC2
Synonyms:
  • 2-Chloro-N-[1-(3-cyano-2-pyridinyl)-4-piperidinyl]acetamide
  • Acetamide, 2-chloro-N-[1-(3-cyano-2-pyridinyl)-4-piperidinyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.