CAS 1065484-50-5
:2-Chloro-N-[1-(3-cyano-2-pyridinyl)-3-piperidinyl]acetamide
Description:
2-Chloro-N-[1-(3-cyano-2-pyridinyl)-3-piperidinyl]acetamide is a chemical compound characterized by its complex structure, which includes a chloro group, a cyano group, and a piperidine ring. This compound features a chloro substituent on the acetamide moiety, which can influence its reactivity and solubility. The presence of the cyano group attached to a pyridine ring contributes to its potential biological activity, as cyano-containing compounds often exhibit interesting pharmacological properties. The piperidine ring adds to the compound's basicity and can affect its interaction with biological targets. Typically, compounds like this may be investigated for their potential use in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. Its molecular interactions, stability, and solubility in different solvents are crucial for understanding its behavior in biological systems. Overall, the unique combination of functional groups in this compound suggests potential applications in drug development and research.
Formula:C13H15ClN4O
InChI:InChI=1S/C13H15ClN4O/c14-7-12(19)17-11-4-2-6-18(9-11)13-10(8-15)3-1-5-16-13/h1,3,5,11H,2,4,6-7,9H2,(H,17,19)
InChI key:InChIKey=WRMGNGVBEDTTNE-UHFFFAOYSA-N
SMILES:C(#N)C1=C(N2CC(NC(CCl)=O)CCC2)N=CC=C1
Synonyms:- 2-Chloro-N-[1-(3-cyano-2-pyridinyl)-3-piperidinyl]acetamide
- Acetamide, 2-chloro-N-[1-(3-cyano-2-pyridinyl)-3-piperidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Chloro-N-(1-(3-cyanopyridin-2-yl)piperidin-3-yl)acetamide
CAS:Formula:C13H15ClN4OMolecular weight:278.7374
