CAS 1065484-54-9
:2-Chloro-N-[1-(2-thiazolyl)-4-piperidinyl]acetamide
Description:
2-Chloro-N-[1-(2-thiazolyl)-4-piperidinyl]acetamide is a chemical compound characterized by its unique structural features, which include a chloro group, a thiazole ring, and a piperidine moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential biological activity due to its complex structure. The presence of the thiazole ring may contribute to its pharmacological properties, as thiazoles are often found in biologically active compounds. The chloro substituent can influence the compound's reactivity and interaction with biological targets. Additionally, the piperidine ring can enhance the compound's ability to interact with various receptors or enzymes, making it of interest in medicinal chemistry. Overall, 2-Chloro-N-[1-(2-thiazolyl)-4-piperidinyl]acetamide is a compound that may possess significant therapeutic potential, warranting further investigation into its biological effects and applications.
Formula:C10H14ClN3OS
InChI:InChI=1S/C10H14ClN3OS/c11-7-9(15)13-8-1-4-14(5-2-8)10-12-3-6-16-10/h3,6,8H,1-2,4-5,7H2,(H,13,15)
InChI key:InChIKey=YUOZFOHLHVLMDP-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)C1CCN(CC1)C2=NC=CS2
Synonyms:- Acetamide, 2-chloro-N-[1-(2-thiazolyl)-4-piperidinyl]-
- 2-Chloro-N-[1-(2-thiazolyl)-4-piperidinyl]acetamide
- 2-Chloro-N-(1-thiazol-2-yl-piperidin-4-yl)-acetaMide, 98+% C10H14ClN3OS, MW: 259.76
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.