CAS 1065484-65-2

2-Bromo-3-[(6-bromo-2-pyridinyl)oxy]pyridine

Description:

2-Bromo-3-[(6-bromo-2-pyridinyl)oxy]pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with bromine and an ether linkage to another pyridine derivative. This compound typically exhibits properties common to halogenated pyridines, such as increased reactivity due to the presence of bromine atoms, which can participate in nucleophilic substitution reactions. The presence of the ether functional group may influence its solubility and polarity, making it more soluble in organic solvents. Additionally, the compound may exhibit biological activity, as many pyridine derivatives are known for their pharmacological properties. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The compound's stability, reactivity, and potential interactions with biological targets would be of interest in both synthetic and applied chemistry contexts. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.

Formula: C₁₀H₆Br₂N₂O

InChI: InChI=1S/C10H6Br2N2O/c11-8-4-1-5-9(14-8)15-7-3-2-6-13-10(7)12/h1-6H

InChI key: InChIKey=YLGQBNLYVXFLAJ-UHFFFAOYSA-N

SMILES: O(C=1N=C(Br)C=CC1)C2=C(Br)N=CC=C2

Synonyms:

• Pyridine, 2-bromo-3-[(6-bromo-2-pyridinyl)oxy]-
• 2-Bromo-3-[(6-bromo-2-pyridinyl)oxy]pyridine