CAS 1065484-66-3
:2-Bromo-3-[[5-(chloromethyl)-2-pyridinyl]oxy]pyridine
Description:
2-Bromo-3-[[5-(chloromethyl)-2-pyridinyl]oxy]pyridine is a chemical compound characterized by its complex structure, which includes a bromine atom and a chloromethyl group attached to a pyridine ring. This compound features a pyridine moiety that is substituted at the 2 and 3 positions, contributing to its reactivity and potential biological activity. The presence of the bromine and chloromethyl groups suggests that it may participate in nucleophilic substitution reactions, making it useful in organic synthesis and medicinal chemistry. The compound's molecular structure indicates that it may exhibit polar characteristics, influencing its solubility in various solvents. Additionally, the presence of heteroatoms like nitrogen and halogens can impart specific electronic properties, potentially affecting its interaction with biological targets. Overall, 2-Bromo-3-[[5-(chloromethyl)-2-pyridinyl]oxy]pyridine is of interest in research for its potential applications in pharmaceuticals and agrochemicals, although specific biological activities would require further investigation.
Formula:C11H8BrClN2O
InChI:InChI=1S/C11H8BrClN2O/c12-11-9(2-1-5-14-11)16-10-4-3-8(6-13)7-15-10/h1-5,7H,6H2
InChI key:InChIKey=LJENIUAIEXPBAG-UHFFFAOYSA-N
SMILES:O(C1=C(Br)N=CC=C1)C2=CC=C(CCl)C=N2
Synonyms:- 2-Bromo-3-[[5-(chloromethyl)-2-pyridinyl]oxy]pyridine
- Pyridine, 2-bromo-3-[[5-(chloromethyl)-2-pyridinyl]oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.