CymitQuimica logo

CAS 1065484-68-5

:

4-[(2-Bromo-3-pyridinyl)oxy]-6-chloropyrimidine

Description:
4-[(2-Bromo-3-pyridinyl)oxy]-6-chloropyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3. The presence of a 2-bromo-3-pyridinyl group at one position and a chlorine atom at another position contributes to its unique reactivity and potential biological activity. This compound is typically used in medicinal chemistry and may exhibit properties relevant to pharmaceutical applications, particularly in the development of targeted therapies. Its structure suggests that it may interact with specific biological targets, making it of interest in drug discovery. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many halogenated compounds, it may also exhibit specific toxicological profiles that necessitate careful handling and assessment in laboratory settings. Overall, 4-[(2-Bromo-3-pyridinyl)oxy]-6-chloropyrimidine represents a class of compounds that are valuable in research and development within the field of organic and medicinal chemistry.
Formula:C9H5BrClN3O
InChI:InChI=1S/C9H5BrClN3O/c10-9-6(2-1-3-12-9)15-8-4-7(11)13-5-14-8/h1-5H
InChI key:InChIKey=WPJWVSXMGRUQPY-UHFFFAOYSA-N
SMILES:O(C=1C=C(Cl)N=CN1)C2=C(Br)N=CC=C2
Synonyms:
  • Pyrimidine, 4-[(2-bromo-3-pyridinyl)oxy]-6-chloro-
  • 4-[(2-Bromo-3-pyridinyl)oxy]-6-chloropyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.