CAS 1065484-69-6
:2-Bromo-3-[[5-(chloromethyl)-2-thiazolyl]oxy]pyridine
Description:
2-Bromo-3-[[5-(chloromethyl)-2-thiazolyl]oxy]pyridine is a chemical compound characterized by its complex structure, which includes a bromine atom, a pyridine ring, and a thiazole moiety. The presence of the bromine atom suggests that it may exhibit reactivity typical of haloalkanes, potentially participating in nucleophilic substitution reactions. The thiazole group, known for its heterocyclic properties, can contribute to biological activity, making this compound of interest in medicinal chemistry. The chloromethyl group enhances the compound's reactivity, allowing for further functionalization. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its polar functional groups. Its unique combination of elements and functional groups may impart specific pharmacological properties, making it a candidate for research in drug development or agrochemicals. Safety data and handling precautions should be observed, as halogenated compounds can pose health risks. Overall, 2-Bromo-3-[[5-(chloromethyl)-2-thiazolyl]oxy]pyridine is a versatile compound with potential applications in various fields.
Formula:C9H6BrClN2OS
InChI:InChI=1S/C9H6BrClN2OS/c10-8-7(2-1-3-12-8)14-9-13-5-6(4-11)15-9/h1-3,5H,4H2
InChI key:InChIKey=JJCHLEQLNPARIV-UHFFFAOYSA-N
SMILES:O(C=1SC(CCl)=CN1)C2=C(Br)N=CC=C2
Synonyms:- 2-Bromo-3-[[5-(chloromethyl)-2-thiazolyl]oxy]pyridine
- Pyridine, 2-bromo-3-[[5-(chloromethyl)-2-thiazolyl]oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Bromo-3-[[5-(chloromethyl)-2-thiazolyl]oxy]pyridine
CAS:Formula:C9H6BrClN2OSMolecular weight:305.5787
