CymitQuimica logo

CAS 1065484-70-9

:

3-[(2-Bromo-3-pyridinyl)oxy]-6-chloropyridazine

Description:
3-[(2-Bromo-3-pyridinyl)oxy]-6-chloropyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a bromine atom at the 2-position of a pyridine ring and a chlorine atom at the 6-position of the pyridazine contributes to its reactivity and potential biological activity. The compound features an ether linkage, indicated by the "oxy" group, which connects the brominated pyridine to the chlorinated pyridazine. This structural arrangement suggests that the compound may exhibit interesting pharmacological properties, potentially acting as a ligand or inhibitor in various biochemical pathways. Its molecular structure may also influence its solubility, stability, and interaction with biological targets. As with many halogenated compounds, it is essential to consider the environmental and health implications associated with its use and disposal. Further studies would be necessary to fully elucidate its properties and potential applications in medicinal chemistry or other fields.
Formula:C9H5BrClN3O
InChI:InChI=1S/C9H5BrClN3O/c10-9-6(2-1-5-12-9)15-8-4-3-7(11)13-14-8/h1-5H
InChI key:InChIKey=AERSMHFXOLIMOA-UHFFFAOYSA-N
SMILES:O(C1=C(Br)N=CC=C1)C2=CC=C(Cl)N=N2
Synonyms:
  • Pyridazine, 3-[(2-bromo-3-pyridinyl)oxy]-6-chloro-
  • 3-[(2-Bromo-3-pyridinyl)oxy]-6-chloropyridazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.