CymitQuimica logo

CAS 1065484-77-6

:

2-Bromo-3-(2-pyridinylmethoxy)pyridine

Description:
2-Bromo-3-(2-pyridinylmethoxy)pyridine is a chemical compound characterized by its unique structure, which includes a bromine atom and a pyridine ring. This compound features a pyridine moiety substituted with a methoxy group linked to another pyridine ring, contributing to its potential biological activity. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in organic synthesis and medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. Additionally, the presence of multiple heteroatoms in the structure may influence its interaction with biological systems, making it a subject of interest for further research in drug discovery and development. Safety and handling precautions should be observed, as with many brominated compounds, due to potential toxicity and environmental concerns.
Formula:C11H9BrN2O
InChI:InChI=1S/C11H9BrN2O/c12-11-10(5-3-7-14-11)15-8-9-4-1-2-6-13-9/h1-7H,8H2
InChI key:InChIKey=BLPUECYSYPBJPY-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=N1)C2=C(Br)N=CC=C2
Synonyms:
  • Pyridine, 2-bromo-3-(2-pyridinylmethoxy)-
  • 2-Bromo-3-(2-pyridinylmethoxy)pyridine
  • 2-BroMo-3-(pyridin-2-ylMethoxy)-pyridine, 98+% C11H9BrN2O, MW: 265.11
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.