CymitQuimica logo

CAS 1065484-78-7

:

2-[[5-(Chloromethyl)-2-thiazolyl]oxy]quinoxaline

Description:
2-[[5-(Chloromethyl)-2-thiazolyl]oxy]quinoxaline is a chemical compound characterized by its unique structural features, which include a quinoxaline core and a thiazole ring. The presence of a chloromethyl group enhances its reactivity, making it a potential candidate for various chemical reactions. This compound is typically classified as an organic heterocyclic compound due to the incorporation of nitrogen and sulfur atoms in its structure. It may exhibit biological activity, which could be of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Additionally, its molecular interactions may be influenced by the functional groups present, making it a subject of study in medicinal chemistry and material science. Overall, 2-[[5-(Chloromethyl)-2-thiazolyl]oxy]quinoxaline represents a versatile structure with potential applications in various fields, including drug development and synthetic chemistry.
Formula:C12H8ClN3OS
InChI:InChI=1S/C12H8ClN3OS/c13-5-8-6-15-12(18-8)17-11-7-14-9-3-1-2-4-10(9)16-11/h1-4,6-7H,5H2
InChI key:InChIKey=VRVGCELOCBTQPF-UHFFFAOYSA-N
SMILES:O(C1=NC2=C(N=C1)C=CC=C2)C=3SC(CCl)=CN3
Synonyms:
  • 2-[[5-(Chloromethyl)-2-thiazolyl]oxy]quinoxaline
  • Quinoxaline, 2-[[5-(chloromethyl)-2-thiazolyl]oxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.