CAS 1065484-79-8
:2-[[5-(Chloromethyl)-2-pyridinyl]oxy]quinoxaline
Description:
2-[[5-(Chloromethyl)-2-pyridinyl]oxy]quinoxaline is a chemical compound characterized by its complex structure, which includes a quinoxaline core and a chloromethyl-substituted pyridine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and the ability to participate in various chemical reactions due to the presence of functional groups. The chloromethyl group can enhance reactivity, making it a useful intermediate in organic synthesis. Additionally, the presence of the pyridine ring may contribute to its solubility in polar solvents and its ability to form coordination complexes with metal ions. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. As with many heterocycles, it may also exhibit fluorescence properties, which can be advantageous in analytical applications. Overall, the characteristics of this compound make it a subject of interest in both synthetic and applied chemistry contexts.
Formula:C14H10ClN3O
InChI:InChI=1S/C14H10ClN3O/c15-7-10-5-6-13(17-8-10)19-14-9-16-11-3-1-2-4-12(11)18-14/h1-6,8-9H,7H2
InChI key:InChIKey=PISIFVOFSBOMFB-UHFFFAOYSA-N
SMILES:O(C1=NC2=C(N=C1)C=CC=C2)C3=CC=C(CCl)C=N3
Synonyms:- 2-[[5-(Chloromethyl)-2-pyridinyl]oxy]quinoxaline
- Quinoxaline, 2-[[5-(chloromethyl)-2-pyridinyl]oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.