CAS 1065484-81-2
:2-[(6-Chloro-4-pyrimidinyl)oxy]quinoxaline
Description:
2-[(6-Chloro-4-pyrimidinyl)oxy]quinoxaline is a chemical compound characterized by its unique structural features, which include a quinoxaline core and a pyrimidine moiety. The presence of a chlorine atom at the 6-position of the pyrimidine ring contributes to its reactivity and potential biological activity. This compound is typically classified as an organic heterocyclic compound, which may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, possibly influencing pathways related to cell signaling or enzyme activity. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions or electrophilic additions. Overall, 2-[(6-Chloro-4-pyrimidinyl)oxy]quinoxaline represents a class of compounds that could be explored for their therapeutic potential in drug development.
Formula:C12H7ClN4O
InChI:InChI=1S/C12H7ClN4O/c13-10-5-11(16-7-15-10)18-12-6-14-8-3-1-2-4-9(8)17-12/h1-7H
InChI key:InChIKey=XTYJLMXADPCDIZ-UHFFFAOYSA-N
SMILES:O(C1=NC2=C(N=C1)C=CC=C2)C=3C=C(Cl)N=CN3
Synonyms:- Quinoxaline, 2-[(6-chloro-4-pyrimidinyl)oxy]-
- 2-[(6-Chloro-4-pyrimidinyl)oxy]quinoxaline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.