CymitQuimica logo

CAS 1065484-83-4

:

2-[(6-Bromo-2-pyridinyl)oxy]quinoxaline

Description:
2-[(6-Bromo-2-pyridinyl)oxy]quinoxaline is a chemical compound characterized by its unique structure, which consists of a quinoxaline core substituted with a 6-bromo-2-pyridinyl group via an ether linkage. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of both the quinoxaline and pyridine moieties. The bromine substituent can influence the compound's reactivity and solubility, while the pyridine ring may contribute to its ability to interact with biological targets. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. Additionally, the presence of halogens like bromine can enhance the compound's lipophilicity, affecting its pharmacokinetic properties. Overall, 2-[(6-Bromo-2-pyridinyl)oxy]quinoxaline represents a class of compounds that are of interest for their synthetic versatility and potential therapeutic applications.
Formula:C13H8BrN3O
InChI:InChI=1S/C13H8BrN3O/c14-11-6-3-7-12(17-11)18-13-8-15-9-4-1-2-5-10(9)16-13/h1-8H
InChI key:InChIKey=JCOMMMPDWJVTJO-UHFFFAOYSA-N
SMILES:O(C1=NC2=C(N=C1)C=CC=C2)C=3N=C(Br)C=CC3
Synonyms:
  • Quinoxaline, 2-[(6-bromo-2-pyridinyl)oxy]-
  • 2-[(6-Bromo-2-pyridinyl)oxy]quinoxaline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.