CAS 1065484-84-5
:2-(2-Furanylmethoxy)-5-nitropyridine
Description:
2-(2-Furanylmethoxy)-5-nitropyridine, identified by its CAS number 1065484-84-5, is an organic compound that features a pyridine ring substituted with both a nitro group and a furanylmethoxy group. The presence of the nitro group typically imparts significant electron-withdrawing properties, influencing the compound's reactivity and potential applications in various chemical reactions. The furanylmethoxy moiety contributes to the compound's overall polarity and may enhance its solubility in organic solvents. This compound is likely to exhibit interesting biological activities due to its structural characteristics, making it a candidate for research in medicinal chemistry. Additionally, the combination of heteroatoms in its structure may lead to unique interactions in biological systems. As with many nitro-containing compounds, it is essential to handle this substance with care, considering potential toxicity and environmental impact. Overall, 2-(2-Furanylmethoxy)-5-nitropyridine represents a valuable compound for further exploration in both synthetic and applied chemistry contexts.
Formula:C10H8N2O4
InChI:InChI=1S/C10H8N2O4/c13-12(14)8-3-4-10(11-6-8)16-7-9-2-1-5-15-9/h1-6H,7H2
InChI key:InChIKey=DQTSFYSTYVVZHJ-UHFFFAOYSA-N
SMILES:O(CC1=CC=CO1)C2=CC=C(N(=O)=O)C=N2
Synonyms:- Pyridine, 2-(2-furanylmethoxy)-5-nitro-
- 2-(2-Furanylmethoxy)-5-nitropyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.