CAS 1065484-88-9

5-(Chloromethyl)-2-(2-furanylmethoxy)thiazole

Description:

5-(Chloromethyl)-2-(2-furanylmethoxy)thiazole is a chemical compound characterized by its unique structural features, which include a thiazole ring, a chloromethyl group, and a furanylmethoxy substituent. The thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The presence of the chloromethyl group enhances its reactivity, making it a useful intermediate in organic synthesis. The furanylmethoxy group adds to the compound's complexity and may influence its solubility and interaction with biological targets. This compound is typically synthesized through multi-step reactions involving specific reagents and conditions to ensure the desired functional groups are introduced correctly. Its applications may span across medicinal chemistry, where it could serve as a lead compound for drug development, or in materials science, depending on its properties. As with many synthetic compounds, safety and handling precautions are essential due to the presence of reactive chlorine and potential toxicity associated with thiazole derivatives.

Formula: C₉H₈ClNO₂S

InChI: InChI=1S/C9H8ClNO2S/c10-4-8-5-11-9(14-8)13-6-7-2-1-3-12-7/h1-3,5H,4,6H2

InChI key: InChIKey=DIYGQGYAKVVWFG-UHFFFAOYSA-N

SMILES: O(CC1=CC=CO1)C=2SC(CCl)=CN2

Synonyms:

• 5-(Chloromethyl)-2-(2-furanylmethoxy)thiazole
• Thiazole, 5-(chloromethyl)-2-(2-furanylmethoxy)-