CAS 1065484-89-0

2-Bromo-6-(2-furanylmethoxy)pyridine

Description:

2-Bromo-6-(2-furanylmethoxy)pyridine is an organic compound characterized by its unique structural features, which include a pyridine ring substituted with a bromine atom and a furanylmethoxy group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The furanylmethoxy group contributes to the compound's aromaticity and can influence its solubility and reactivity due to the electron-donating properties of the methoxy group. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on its specific interactions with solvents and other reagents. Overall, 2-Bromo-6-(2-furanylmethoxy)pyridine represents a versatile structure in organic chemistry with potential applications in various fields.

Formula: C₁₀H₈BrNO₂

InChI: InChI=1S/C10H8BrNO2/c11-9-4-1-5-10(12-9)14-7-8-3-2-6-13-8/h1-6H,7H2

InChI key: InChIKey=ZOJIRBPVVSLFLE-UHFFFAOYSA-N

SMILES: O(CC1=CC=CO1)C=2N=C(Br)C=CC2

Synonyms:

• Pyridine, 2-bromo-6-(2-furanylmethoxy)-
• 2-Bromo-6-(2-furanylmethoxy)pyridine