
CAS 106556-64-3
:N-(3-Methoxy-3-oxopropyl)-2-methylalanine methyl ester
Description:
N-(3-Methoxy-3-oxopropyl)-2-methylalanine methyl ester, with the CAS number 106556-64-3, is an organic compound that features a complex structure characterized by the presence of an amino acid derivative. This substance contains a methyl ester functional group, which typically enhances its solubility in organic solvents and may influence its reactivity. The methoxy and oxopropyl groups contribute to its unique chemical properties, potentially affecting its polarity and interaction with biological systems. As an amino acid derivative, it may exhibit characteristics such as chirality, which can influence its biological activity and interactions with enzymes or receptors. The compound's structure suggests potential applications in pharmaceuticals or biochemistry, particularly in the synthesis of peptide-based drugs or as a building block in organic synthesis. However, specific details regarding its reactivity, stability, and biological activity would require further investigation through experimental studies or literature review.
Formula:C9H17NO4
InChI:InChI=1S/C9H17NO4/c1-9(2,8(12)14-4)10-6-5-7(11)13-3/h10H,5-6H2,1-4H3
InChI key:InChIKey=RSWMHAKZMAPORV-UHFFFAOYSA-N
SMILES:N(C(C(OC)=O)(C)C)CCC(OC)=O
Synonyms:- N-(3-Methoxy-3-oxopropyl)-2-methylalanine methyl ester
- Alanine, N-(3-methoxy-3-oxopropyl)-2-methyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.