CymitQuimica logo

CAS 106556-67-6

:

Ethyl 4-bromo-2,3-dihydro-2,2-dimethyl-3-oxo-1H-pyrrole-1-carboxylate

Description:
Ethyl 4-bromo-2,3-dihydro-2,2-dimethyl-3-oxo-1H-pyrrole-1-carboxylate, with the CAS number 106556-67-6, is a chemical compound characterized by its pyrrole structure, which is a five-membered aromatic ring containing nitrogen. This compound features a bromo substituent, which enhances its reactivity and potential applications in organic synthesis. The presence of the ethyl ester group contributes to its solubility in organic solvents and may influence its biological activity. The dihydro and dimethyl groups indicate that the compound has a saturated framework, which can affect its stability and reactivity. Additionally, the keto group (3-oxo) suggests potential for further chemical transformations, making it a versatile intermediate in synthetic chemistry. Overall, this compound may be of interest in medicinal chemistry and materials science due to its unique structural features and potential reactivity.
Formula:C9H12BrNO3
InChI:InChI=1S/C9H12BrNO3/c1-4-14-8(13)11-5-6(10)7(12)9(11,2)3/h5H,4H2,1-3H3
InChI key:InChIKey=SFTWIANMYYAKMK-UHFFFAOYSA-N
SMILES:C(OCC)(=O)N1C(C)(C)C(=O)C(Br)=C1
Synonyms:
  • 1H-Pyrrole-1-carboxylic acid, 4-bromo-2,3-dihydro-2,2-dimethyl-3-oxo-, ethyl ester
  • Ethyl 4-bromo-2,3-dihydro-2,2-dimethyl-3-oxo-1H-pyrrole-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.