CAS 106558-68-3
:1-(4-BROMOBUTOXY)-2-FLUOROBENZENE
Description:
1-(4-Bromobutoxy)-2-fluorobenzene is an organic compound characterized by its aromatic structure, which includes a fluorine atom and a bromobutoxy substituent. The presence of the bromine atom introduces significant electronegativity, influencing the compound's reactivity and polarity. The butoxy group, which is a butyl chain attached to an oxygen atom, contributes to the compound's hydrophobic characteristics, while the fluorine atom enhances its potential for interactions such as hydrogen bonding and dipole-dipole interactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as boiling point and solubility, are influenced by the balance between the hydrophobic butoxy group and the polar functional groups. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose environmental and health risks. Overall, 1-(4-Bromobutoxy)-2-fluorobenzene exemplifies the complexity of organic compounds with multiple functional groups.
Formula:C10H12BrFO
InChI:InChI=1/C10H12BrFO/c11-7-3-4-8-13-10-6-2-1-5-9(10)12/h1-2,5-6H,3-4,7-8H2
SMILES:c1ccc(c(c1)F)OCCCCBr
Synonyms:- 2-Fluorophenoxybutylbromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
