CAS 106562-32-7
:7-AMINO-4-METHYL-3-COUMARINYLACETIC ACID
Description:
7-Amino-4-methyl-3-coumarinylacetic acid is a synthetic compound characterized by its coumarin structure, which is a benzopyrone derivative known for its fluorescence and potential biological activities. This compound features an amino group, a methyl group, and an acetic acid moiety, contributing to its solubility and reactivity. It typically exhibits properties such as being a fluorescent dye, making it useful in various applications, including biological imaging and as a probe in biochemical assays. The presence of the amino group enhances its potential for forming hydrogen bonds, which can influence its interaction with biological targets. Additionally, the coumarin backbone is associated with various pharmacological activities, including anti-inflammatory and antimicrobial properties. The compound's solubility in polar solvents and its stability under standard laboratory conditions are also notable characteristics. Overall, 7-amino-4-methyl-3-coumarinylacetic acid is a versatile compound with significant implications in research and potential therapeutic applications.
Formula:C12H11NO4
InChI:InChI=1/C12H11NO4/c1-6-8-3-2-7(13)4-10(8)17-12(16)9(6)5-11(14)15/h2-4H,5,13H2,1H3,(H,14,15)
SMILES:Cc1c2ccc(cc2oc(=O)c1CC(=O)O)N
Synonyms:- Amca-H
- 7-Amino-4-Methyl-2-Oxo-2H-Chromen-3-Yl Acetic Acid
- 2H-1-Benzopyran-3-acetic acid, 7-amino-4-methyl-2-oxo-
- Amino-Methyl-Coumarinaceticacid
- 7-Amino-4-Methyl-3-Coumarinylacetic Acid Biochemika, For Fluorescence 90%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
7-Amino-4-methylcoumarin-3-acetic Acid
CAS:Formula:C12H11NO4Purity:>95.0%(T)(HPLC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:233.222-(7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid
CAS:Formula:C12H11NO4Purity:97%Color and Shape:SolidMolecular weight:233.22007-Amino-4-methylcoumarin-3-acetic acid
CAS:7-Amino-4-methylcoumarin-3-acetic acidPurity:≥95%Molecular weight:233.22g/mol2-(7-Amino-4-Methyl-2-Oxo-2H-Chromen-3-Yl)Acetic Acid
CAS:2-(7-Amino-4-Methyl-2-Oxo-2H-Chromen-3-Yl)Acetic AcidPurity:99%Molecular weight:233.22g/mol7-Amino-4-methyl-3-coumarinylacetic acid
CAS:Formula:C12H11NO4Purity:95%~99%Color and Shape:Cryst.Molecular weight:233.2237-Amino-4-methylcoumarin-3-acetic acid
CAS:<p>7-Amino-4-methylcoumarin-3-acetic acid (7-Amino-4-methylcoumarin) is more suitable as a substrate for enteropeptidase than GD(4)K-NA.</p>Formula:C12H11NO4Purity:98.38%Color and Shape:SolidMolecular weight:233.222-(7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid
CAS:Formula:C12H11NO4Purity:97%Color and Shape:SolidMolecular weight:233.2237-Amino-4-methyl-3-coumarinylacetic acid
CAS:Controlled Product<p>Applications 7-Amino-4-methyl-3-coumarinylacetic acid is a blue fluorophore useful for immunofluorescence and peptide labeling.<br></p>Formula:C12H11NO4Color and Shape:NeatMolecular weight:233.222-(7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid
CAS:<p>2-(7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid is a monoclonal antibody that recognizes basic proteins. It is used to study the receptor binding of these proteins and their role in inflammatory diseases. 2-(7-Amino-4-methyl-2-oxo-2H-chromen-3,6-)acetic acid is an amino function that enhances the localization of cholinergic receptors at the apical membrane of epithelial cells. It also inhibits the efflux pump activity of bacteria, which may be useful for treating bacterial infections.</p>Formula:C12H11NO4Purity:Min. 95%Molecular weight:233.22 g/mol








