CAS 106589-22-4
:3-Cyano-2-iodobenzoic acid
Description:
3-Cyano-2-iodobenzoic acid is an organic compound characterized by the presence of a cyano group (-CN) and an iodine atom attached to a benzoic acid structure. It features a benzene ring with a carboxylic acid group (-COOH) and is known for its potential applications in pharmaceuticals and organic synthesis. The cyano group contributes to its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The iodine atom enhances its electrophilic properties, which can facilitate further functionalization. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its molecular structure allows for various interactions, including hydrogen bonding due to the carboxylic acid group. Additionally, 3-Cyano-2-iodobenzoic acid can be utilized in the development of biologically active molecules, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as it may pose health risks typical of halogenated compounds.
Formula:C8H4INO2
InChI:InChI=1S/C8H4INO2/c9-7-5(4-10)2-1-3-6(7)8(11)12/h1-3H,(H,11,12)
InChI key:InChIKey=LYQYOMPRHIJZGV-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(I)C(C#N)=CC=C1
Synonyms:- Benzoic acid, 3-cyano-2-iodo-
- 3-Cyano-2-iodobenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
