CAS 106591-88-2
:5-(3,4-dimethoxyphenyl)-3-methyl-5-oxopentanoic acid
Description:
5-(3,4-Dimethoxyphenyl)-3-methyl-5-oxopentanoic acid, with the CAS number 106591-88-2, is an organic compound characterized by its complex structure, which includes a pentanoic acid backbone substituted with a dimethoxyphenyl group and a ketone functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the dimethoxyphenyl moiety suggests that it may engage in various interactions, including hydrogen bonding and π-π stacking, which can influence its biological activity and solubility in organic solvents. The methyl and oxo groups further modify its chemical behavior, potentially enhancing its reactivity in condensation or substitution reactions. As a result, this compound may be of interest in medicinal chemistry and material science, where its unique structural features could be leveraged for the development of pharmaceuticals or functional materials. However, specific applications and biological activities would require further investigation through empirical studies.
Formula:C14H18O5
InChI:InChI=1/C14H18O5/c1-9(7-14(16)17)6-11(15)10-4-5-12(18-2)13(8-10)19-3/h4-5,8-9H,6-7H2,1-3H3,(H,16,17)
SMILES:CC(CC(=O)c1ccc(c(c1)OC)OC)CC(=O)O
Synonyms:- Benzenepentanoic acid, 3,4-dimethoxy-beta-methyl-delta-oxo-
- 5-(3,4-Dimethoxyphenyl)-3-methyl-5-oxopentanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.