
CAS 106595-73-7
:4-Amino-N-[3-(diethylamino)propyl]benzamide
Description:
4-Amino-N-[3-(diethylamino)propyl]benzamide, with the CAS number 106595-73-7, is a chemical compound characterized by its amine and amide functional groups. It features a benzamide structure, where an amino group is attached to the benzene ring, enhancing its potential for hydrogen bonding and reactivity. The presence of the diethylamino group contributes to its basicity and lipophilicity, which can influence its solubility in organic solvents and biological systems. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, reactivity, and potential toxicity would need to be assessed in a laboratory setting to understand its behavior in various environments. Overall, 4-Amino-N-[3-(diethylamino)propyl]benzamide represents a versatile molecule with implications in both chemical research and drug development.
Formula:C14H23N3O
InChI:InChI=1S/C14H23N3O/c1-3-17(4-2)11-5-10-16-14(18)12-6-8-13(15)9-7-12/h6-9H,3-5,10-11,15H2,1-2H3,(H,16,18)
InChI key:InChIKey=CAZRUCADWYKNSP-UHFFFAOYSA-N
SMILES:C(NCCCN(CC)CC)(=O)C1=CC=C(N)C=C1
Synonyms:- 4-Amino-N-[3-(diethylamino)propyl]benzamide
- Benzamide, 4-amino-N-[3-(diethylamino)propyl]-
- NSC 16097
- Benzamide, p-amino-N-(3-diethylaminopropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.