CymitQuimica logo

CAS 106595-91-9

:

4-benzyl-3,4-dihydroquinoxalin-2(1H)-one

Description:
4-Benzyl-3,4-dihydroquinoxalin-2(1H)-one is a chemical compound characterized by its unique bicyclic structure, which includes a quinoxaline moiety. This compound features a benzyl group attached to the nitrogen of the quinoxaline ring, contributing to its potential biological activity. It typically appears as a solid at room temperature and is soluble in organic solvents. The presence of the carbonyl group in the structure suggests that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. This compound has garnered interest in medicinal chemistry due to its potential pharmacological properties, including neuroprotective and anti-inflammatory effects. Its synthesis often involves multi-step organic reactions, and it may serve as a scaffold for the development of new therapeutic agents. As with many organic compounds, proper handling and storage are essential to maintain its stability and prevent degradation. Overall, 4-benzyl-3,4-dihydroquinoxalin-2(1H)-one represents a significant compound in the field of organic and medicinal chemistry.
Formula:C15H14N2O
InChI:InChI=1/C15H14N2O/c18-15-11-17(10-12-6-2-1-3-7-12)14-9-5-4-8-13(14)16-15/h1-9H,10-11H2,(H,16,18)
InChI key:BSCQZYGHGGBKLI-UHFFFAOYSA-N
SMILES:c1ccc(cc1)CN1CC(=Nc2ccccc12)O
Synonyms:
  • 2(1H)-Quinoxalinone, 3,4-dihydro-4-(phenylmethyl)-
Found 4 products.