CymitQuimica logo

CAS 106602-54-4

:

halonal

Description:
Halonal, identified by the CAS number 106602-54-4, is a chemical compound that belongs to the class of halogenated organic compounds. It is characterized by its complex molecular structure, which typically includes halogen atoms such as bromine or chlorine. Halonal is primarily recognized for its applications in various industrial processes, particularly in the field of fire suppression and as a potential intermediate in chemical synthesis. The compound exhibits properties such as stability under normal conditions, but it may undergo degradation when exposed to extreme temperatures or reactive environments. Additionally, halonal's environmental impact and potential toxicity are subjects of ongoing research, particularly concerning its persistence in the environment and effects on human health. As with many halogenated compounds, safety precautions are essential when handling halonal to mitigate risks associated with exposure. Overall, halonal serves as an important example of how halogenated compounds can be utilized in both industrial applications and environmental studies.
Formula:C19H15FN2O4
InChI:InChI=1/C19H15FN2O4/c1-2-19(12-8-4-3-5-9-12)16(24)21-18(26)22(17(19)25)15(23)13-10-6-7-11-14(13)20/h3-11H,2H2,1H3,(H,21,24,26)
SMILES:CCC1(c2ccccc2)C(=NC(=O)N(C(=O)c2ccccc2F)C1=O)O
Synonyms:
  • 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-ethyl-1-(2-fluorobenzoyl)-5-phenyl-
  • 5-ethyl-1-(2-fluorobenzoyl)-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione
  • Halonal
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.