CAS 106629-90-7
:3,3'-(3,3'-DIMETHOXY-4,4'-DIPHENYLENE)BIS(2-PHENYL-5-VERATRYLTETRAZOLIUM CHLORIDE)
Description:
3,3'-(3,3'-Dimethoxy-4,4'-diphenylene)bis(2-phenyl-5-veratryltetrazolium chloride) is a complex organic compound characterized by its unique structure, which includes multiple aromatic rings and functional groups. This compound features a bis(tetrazolium) structure, which is often associated with redox reactions and can serve as a colorimetric indicator in various biochemical assays. The presence of dimethoxy and phenyl groups contributes to its solubility and stability in organic solvents. The tetrazolium moiety is known for its ability to undergo reduction, leading to the formation of formazan derivatives, which are typically colored and can be quantified spectrophotometrically. This compound may be utilized in research settings, particularly in studies involving cell viability, metabolic activity, or as a potential probe in electrochemical applications. Its specific interactions and reactivity can be influenced by the surrounding environment, including pH and the presence of other chemical species. Overall, this substance exemplifies the intricate relationship between molecular structure and chemical behavior in organic chemistry.
Formula:C46H44Cl2N8O6
InChI:InChI=1/C46H44N8O6.2ClH/c1-55-39-23-17-31(25-43(39)59-5)27-45-47-51(35-13-9-7-10-14-35)53(49-45)37-21-19-33(29-41(37)57-3)34-20-22-38(42(30-34)58-4)54-50-46(48-52(54)36-15-11-8-12-16-36)28-32-18-24-40(56-2)44(26-32)60-6;;/h7-26,29-30H,27-28H2,1-6H3;2*1H/q+2;;/p-2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2H-Tetrazolium, 2,2'-(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis[5-[(3,4-dimethoxyphenyl)methyl]-3-phenyl-, chloride (1:2)
CAS:Formula:C46H44ClN8O6Molecular weight:840.3446

