CAS 106656-86-4: 1-(1H-Inden-4-yloxy)-3-[(1-methylethyl)amino]-2-propanol

Description:1-(1H-Inden-4-yloxy)-3-[(1-methylethyl)amino]-2-propanol, with CAS number 106656-86-4, is a chemical compound that exhibits characteristics typical of both aromatic and aliphatic compounds. It features an indene moiety, which contributes to its aromatic properties, and a propanol group that provides alcohol functionality. The presence of an isopropyl amino group suggests potential for biological activity, possibly influencing its interaction with biological systems. This compound may exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic indene structure. Its molecular structure indicates potential for hydrogen bonding, which can affect its physical properties such as boiling point and melting point. Additionally, the compound may have implications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features. Overall, the characteristics of this compound make it a subject of interest in both synthetic and medicinal chemistry contexts.

Formula:C₁₅H₂₁NO₂

InChI:InChI=1S/C15H21NO2/c1-11(2)16-9-13(17)10-18-15-8-4-6-12-5-3-7-14(12)15/h3-4,6-8,11,13,16-17H,5,9-10H2,1-2H3

InChI key:InChIKey=MPGBPFMOOXKQRX-UHFFFAOYSA-N

SMILES:OC(COC1=CC=CC2=C1C=CC2)CNC(C)C